C14H28N2 — CID 163656366
(1E,5R,6S,7Z)-2-N,4,5,6-tetramethyldeca-1,7-diene-1,2-diamine (PubChem CID 163656366) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is (1E,5R,6S,7Z)-2-N,4,5,6-tetramethyldeca-1,7-diene-1,2-diamine.
| Compound Name | (1E,5R,6S,7Z)-2-N,4,5,6-tetramethyldeca-1,7-diene-1,2-diamine |
|---|---|
| PubChem CID | 163656366 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | (1E,5R,6S,7Z)-2-N,4,5,6-tetramethyldeca-1,7-diene-1,2-diamine |
| SMILES | CC/C=C\[C@H](C)[C@H](C)C(C)C/C(=C\N)NC |
| InChI | InChI=1S/C14H28N2/c1-6-7-8-11(2)13(4)12(3)9-14(10-15)16-5/h7-8,10-13,16H,6,9,15H2,1-5H3/b8-7-,14-10+/t11-,12?,13-/m0/s1 |
| InChIKey | IQOJYIODPDXLFC-KPAGQBKFSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|