C12H21NO — CID 163656568
6-methyl-8-(propan-2-yloxymethyl)-1,2,3,5-tetrahydropyrrolizine (PubChem CID 163656568) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 6-methyl-8-(propan-2-yloxymethyl)-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | 6-methyl-8-(propan-2-yloxymethyl)-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 163656568 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 6-methyl-8-(propan-2-yloxymethyl)-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CC1=CC2(COC(C)C)CCCN2C1 |
| InChI | InChI=1S/C12H21NO/c1-10(2)14-9-12-5-4-6-13(12)8-11(3)7-12/h7,10H,4-6,8-9H2,1-3H3 |
| InChIKey | NFOGCJLDNFZMJP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|