C17H18N2O2 — CID 163656635
2-methyl-6-phenacyl-5,6,7,8-tetrahydrocinnolin-3-one (PubChem CID 163656635) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-methyl-6-phenacyl-5,6,7,8-tetrahydrocinnolin-3-one.
| Compound Name | 2-methyl-6-phenacyl-5,6,7,8-tetrahydrocinnolin-3-one |
|---|---|
| PubChem CID | 163656635 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-methyl-6-phenacyl-5,6,7,8-tetrahydrocinnolin-3-one |
| SMILES | Cn1nc2c(cc1=O)CC(CC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C17H18N2O2/c1-19-17(21)11-14-9-12(7-8-15(14)18-19)10-16(20)13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | UMZQYMUPSVZETJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |