C30H40ClNO4S3 — CID 163656988
(5Z)-3-[4-[2-(6-chlorohexoxy)ethoxy]butyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]thiolane-2,4-dione (PubChem CID 163656988) has the molecular formula C30H40ClNO4S3 and a molecular weight of 610.31 g/mol. Its IUPAC name is (5Z)-3-[4-[2-(6-chlorohexoxy)ethoxy]butyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]thiolane-2,4-dione.
| Compound Name | (5Z)-3-[4-[2-(6-chlorohexoxy)ethoxy]butyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]thiolane-2,4-dione |
|---|---|
| PubChem CID | 163656988 |
| Molecular Formula | C30H40ClNO4S3 |
| Molecular Weight | 610.31 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | (5Z)-3-[4-[2-(6-chlorohexoxy)ethoxy]butyl]-5-[[10-(dimethylamino)-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]thiolane-2,4-dione |
| SMILES | CN(C)c1cc2c(s1)-c1sc(/C=C3\SC(=O)C(CCCCOCCOCCCCCCCl)C3=O)cc1C2(C)C |
| InChI | InChI=1S/C30H40ClNO4S3/c1-30(2)22-17-20(37-27(22)28-23(30)19-25(39-28)32(3)4)18-24-26(33)21(29(34)38-24)11-7-10-14-36-16-15-35-13-9-6-5-8-12-31/h17-19,21H,5-16H2,1-4H3/b24-18- |
| InChIKey | IRBZUYSRAUHQJA-MOHJPFBDSA-N |
| XLogP | 7.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.31 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|