About 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile
3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile (PubChem CID 163657887) has the molecular formula C17H19BrN2O
and a molecular weight of 347.26 g/mol. Its IUPAC name is 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile |
| PubChem CID | 163657887 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile |
| SMILES | Cc1cc2c(cc1C#N)c(Br)cn2C[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C17H19BrN2O/c1-11-5-17-15(7-13(11)8-19)16(18)10-20(17)9-12-3-2-4-14(21)6-12/h5,7,10,12,14,21H,2-4,6,9H2,1H3/t12-,14+/m1/s1 |
| InChIKey | IRVGFYHQMYBUEJ-OCCSQVGLSA-N |
| XLogP | 4.14 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile?
The IUPAC name of 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile (CID 163657887) is 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile.
What is the SMILES notation for 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile?
The canonical SMILES for 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile is Cc1cc2c(cc1C#N)c(Br)cn2C[C@@H]1CCC[C@H](O)C1.
What is the InChIKey of 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile?
The InChIKey is IRVGFYHQMYBUEJ-OCCSQVGLSA-N. The full InChI is InChI=1S/C17H19BrN2O/c1-11-5-17-15(7-13(11)8-19)16(18)10-20(17)9-12-3-2-4-14(21)6-12/h5,7,10,12,14,21H,2-4,6,9H2,1H3/t12-,14+/m1/s1.
What are the key properties of 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile?
3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile has a molecular weight of 347.26 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-[[(1R,3S)-3-hydroxycyclohexyl]methyl]-6-methylindole-5-carbonitrile is sourced from PubChem (CID 163657887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).