C11H14 — CID 163658163
(1aS)-3,4-didehydro-1,1a,2,4a,5,6,7,8-octahydrocyclopropa[j]naphthalene (PubChem CID 163658163) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (1aS)-3,4-didehydro-1,1a,2,4a,5,6,7,8-octahydrocyclopropa[j]naphthalene.
| Compound Name | (1aS)-3,4-didehydro-1,1a,2,4a,5,6,7,8-octahydrocyclopropa[j]naphthalene |
|---|---|
| PubChem CID | 163658163 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (1aS)-3,4-didehydro-1,1a,2,4a,5,6,7,8-octahydrocyclopropa[j]naphthalene |
| SMILES | C1#CC2CCCCC23C[C@H]3C1 |
| InChI | InChI=1S/C11H14/c1-2-7-11-8-10(11)6-3-5-9(11)4-1/h9-10H,1-2,4,6-8H2/t9?,10-,11?/m1/s1 |
| InChIKey | ISAMHXXBZRNZPV-HSOILSAZSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|