About N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide
N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide (PubChem CID 163658202) has the molecular formula C19H31N3O2
and a molecular weight of 333.48 g/mol. Its IUPAC name is N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide |
| PubChem CID | 163658202 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide |
| SMILES | CCC1=CC(C)CC(C)C1NC(=O)c1cnn(C)c1OCC(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-7-15-9-13(4)8-14(5)17(15)21-18(23)16-10-20-22(6)19(16)24-11-12(2)3/h9-10,12-14,17H,7-8,11H2,1-6H3,(H,21,23) |
| InChIKey | ISBIVRNRYNBMCS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide?
The IUPAC name of N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide (CID 163658202) is N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide.
What is the SMILES notation for N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide?
The canonical SMILES for N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide is CCC1=CC(C)CC(C)C1NC(=O)c1cnn(C)c1OCC(C)C.
What is the InChIKey of N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide?
The InChIKey is ISBIVRNRYNBMCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O2/c1-7-15-9-13(4)8-14(5)17(15)21-18(23)16-10-20-22(6)19(16)24-11-12(2)3/h9-10,12-14,17H,7-8,11H2,1-6H3,(H,21,23).
What are the key properties of N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide?
N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide has a molecular weight of 333.48 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethyl-4,6-dimethylcyclohex-2-en-1-yl)-1-methyl-5-(2-methylpropoxy)pyrazole-4-carboxamide is sourced from PubChem (CID 163658202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).