C24H46FN8O+ — CID 163658301
3,3-diamino-N-[4-(4-cyclopropylpiperazin-1-yl)piperidin-3-yl]-2-(3-ethyl-5-fluoro-3-propyl-4,5-dihydro-2H-pyrimidin-3-ium-2-yl)propanamide (PubChem CID 163658301) has the molecular formula C24H46FN8O+ and a molecular weight of 481.69 g/mol. Its IUPAC name is 3,3-diamino-N-[4-(4-cyclopropylpiperazin-1-yl)piperidin-3-yl]-2-(3-ethyl-5-fluoro-3-propyl-4,5-dihydro-2H-pyrimidin-3-ium-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-(4-cyclopropylpiperazin-1-yl)piperidin-3-yl]-2-(3-ethyl-5-fluoro-3-propyl-4,5-dihydro-2H-pyrimidin-3-ium-2-yl)propanamide |
|---|---|
| PubChem CID | 163658301 |
| Molecular Formula | C24H46FN8O+ |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.38 |
| IUPAC Name | 3,3-diamino-N-[4-(4-cyclopropylpiperazin-1-yl)piperidin-3-yl]-2-(3-ethyl-5-fluoro-3-propyl-4,5-dihydro-2H-pyrimidin-3-ium-2-yl)propanamide |
| SMILES | CCC[N+]1(CC)CC(F)C=NC1C(C(=O)NC1CNCCC1N1CCN(C2CC2)CC1)C(N)N |
| InChI | InChI=1S/C24H45FN8O/c1-3-13-33(4-2)16-17(25)14-29-23(33)21(22(26)27)24(34)30-19-15-28-8-7-20(19)32-11-9-31(10-12-32)18-5-6-18/h14,17-23,28H,3-13,15-16,26-27H2,1-2H3/p+1 |
| InChIKey | PFIOBIXBFKWNON-UHFFFAOYSA-O |
| XLogP | -0.53 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|