About 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline
4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline (PubChem CID 163658782) has the molecular formula C14H21F2N2Si-
and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline.
Molecular Properties
| Compound Name | 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline |
| PubChem CID | 163658782 |
| Molecular Formula | C14H21F2N2Si- |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(N2CC[SiH-]3(CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C14H21F2N2Si/c15-12-9-11(17)10-13(16)14(12)18-3-7-19(8-4-18)5-1-2-6-19/h9-10,19H,1-8,17H2/q-1 |
| InChIKey | ISOVNJKYWMZAFV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline?
The IUPAC name of 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline (CID 163658782) is 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline.
What is the SMILES notation for 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline?
The canonical SMILES for 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline is Nc1cc(F)c(N2CC[SiH-]3(CCCC3)CC2)c(F)c1.
What is the InChIKey of 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline?
The InChIKey is ISOVNJKYWMZAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21F2N2Si/c15-12-9-11(17)10-13(16)14(12)18-3-7-19(8-4-18)5-1-2-6-19/h9-10,19H,1-8,17H2/q-1.
What are the key properties of 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline?
4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline has a molecular weight of 283.42 g/mol, XLogP of 3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-aza-5-silanuidaspiro[4.5]decan-8-yl)-3,5-difluoroaniline is sourced from PubChem (CID 163658782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).