About N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine
N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine (PubChem CID 163659393) has the molecular formula C2H5N9
and a molecular weight of 155.12 g/mol. Its IUPAC name is N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine.
Molecular Properties
| Compound Name | N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine |
| PubChem CID | 163659393 |
| Molecular Formula | C2H5N9 |
| Molecular Weight | 155.12 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine |
| SMILES | N1=NC(Nc2nn[nH]n2)NN1 |
| InChI | InChI=1S/C2H5N9/c3(1-4-8-9-5-1)2-6-10-11-7-2/h1H,(H,4,9)(H,5,8)(H2,3,6,7,10,11) |
| InChIKey | ITBUINMDSTWCBX-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.12 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine?
The IUPAC name of N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine (CID 163659393) is N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine.
What is the SMILES notation for N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine?
The canonical SMILES for N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine is N1=NC(Nc2nn[nH]n2)NN1.
What is the InChIKey of N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine?
The InChIKey is ITBUINMDSTWCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N9/c3(1-4-8-9-5-1)2-6-10-11-7-2/h1H,(H,4,9)(H,5,8)(H2,3,6,7,10,11).
What are the key properties of N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine?
N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine has a molecular weight of 155.12 g/mol, XLogP of -1.63, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dihydro-1H-tetrazol-5-yl)-2H-tetrazol-5-amine is sourced from PubChem (CID 163659393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).