About 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol
6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol (PubChem CID 163659686) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol.
Analyze 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol (CID 163659686) is 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol is CN/C=C\C1C=CC=CC1O.
What is the InChIKey of 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol?
The InChIKey is ITHUCWUUTYUAMA-SREVYHEPSA-N. The full InChI is InChI=1S/C9H13NO/c1-10-7-6-8-4-2-3-5-9(8)11/h2-11H,1H3/b7-6-.
What are the key properties of 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol?
6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol has a molecular weight of 151.21 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-2-(methylamino)ethenyl]cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 163659686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).