About 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol
3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol (PubChem CID 163660314) has the molecular formula C14H17Cl2NO3
and a molecular weight of 318.20 g/mol. Its IUPAC name is 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol.
Molecular Properties
| Compound Name | 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol |
| PubChem CID | 163660314 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol |
| SMILES | CCNC(CO)C(O)(c1ccc2occc2c1)C(Cl)Cl |
| InChI | InChI=1S/C14H17Cl2NO3/c1-2-17-12(8-18)14(19,13(15)16)10-3-4-11-9(7-10)5-6-20-11/h3-7,12-13,17-19H,2,8H2,1H3 |
| InChIKey | ITVCANLZULBOTJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol?
The IUPAC name of 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol (CID 163660314) is 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol.
What is the SMILES notation for 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol?
The canonical SMILES for 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol is CCNC(CO)C(O)(c1ccc2occc2c1)C(Cl)Cl.
What is the InChIKey of 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol?
The InChIKey is ITVCANLZULBOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO3/c1-2-17-12(8-18)14(19,13(15)16)10-3-4-11-9(7-10)5-6-20-11/h3-7,12-13,17-19H,2,8H2,1H3.
What are the key properties of 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol?
3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol has a molecular weight of 318.20 g/mol, XLogP of 2.39, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzofuran-5-yl)-4,4-dichloro-2-(ethylamino)butane-1,3-diol is sourced from PubChem (CID 163660314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).