C14H17N3O — CID 163660533
6-benzyl-7-imino-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 163660533) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-benzyl-7-imino-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 6-benzyl-7-imino-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 163660533 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 6-benzyl-7-imino-1,2,3,4,4a,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | [H]/N=C1/C2NCCCC2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H17N3O/c15-13-12-11(7-4-8-16-12)14(18)17(13)9-10-5-2-1-3-6-10/h1-3,5-6,11-12,15-16H,4,7-9H2/b15-13- |
| InChIKey | ITZXOFXPVRCYHE-SQFISAMPSA-N |
| XLogP | 1.37 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|