C21H25N9O12P2 — CID 163660946
9-[(6R,8R,10R,15R,17R)-8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 163660946) has the molecular formula C21H25N9O12P2 and a molecular weight of 657.43 g/mol. Its IUPAC name is 9-[(6R,8R,10R,15R,17R)-8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 9-[(6R,8R,10R,15R,17R)-8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 163660946 |
| Molecular Formula | C21H25N9O12P2 |
| Molecular Weight | 657.43 g/mol |
| Exact Mass | 657.11 |
| IUPAC Name | 9-[(6R,8R,10R,15R,17R)-8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)OC3C(O)[C@@H](COP(=O)(O)O[C@@H]2C1O)C[C@H]3n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C21H25N9O12P2/c22-17-11-18(24-4-23-17)30(7-27-11)21-14(32)16-10(40-21)3-39-44(36,37)41-15-9(1-8(13(15)31)2-38-43(34,35)42-16)29-6-28-12-19(29)25-5-26-20(12)33/h4-10,13-16,21,31-32H,1-3H2,(H,34,35)(H,36,37)(H2,22,23,24)(H,25,26,33)/t8-,9-,10-,13?,14?,15?,16+,21-/m1/s1 |
| InChIKey | IUILCGDSWCBOMJ-QMSKYBAUSA-N |
| XLogP | -1.26 |
| TPSA | 294.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.43 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|