C21H23BrN6O6S — CID 163661146
5-(1,3-benzodioxol-5-yl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-[(2-methoxyethylamino)-methylidene-oxo-λ6-sulfanyl]pyrimidin-4-amine (PubChem CID 163661146) has the molecular formula C21H23BrN6O6S and a molecular weight of 567.42 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-[(2-methoxyethylamino)-methylidene-oxo-λ6-sulfanyl]pyrimidin-4-amine.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-[(2-methoxyethylamino)-methylidene-oxo-λ6-sulfanyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163661146 |
| Molecular Formula | C21H23BrN6O6S |
| Molecular Weight | 567.42 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-6-[2-(5-bromopyrimidin-2-yl)oxyethoxy]-N-[(2-methoxyethylamino)-methylidene-oxo-λ6-sulfanyl]pyrimidin-4-amine |
| SMILES | C=S(=O)(NCCOC)Nc1ncnc(OCCOc2ncc(Br)cn2)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23BrN6O6S/c1-30-6-5-27-35(2,29)28-19-18(14-3-4-16-17(9-14)34-13-33-16)20(26-12-25-19)31-7-8-32-21-23-10-15(22)11-24-21/h3-4,9-12H,2,5-8,13H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | IUMFQLRICRVNOX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|