C14H13Al2NS — CID 163661867
CID 163661867 (PubChem CID 163661867) has the molecular formula C14H13Al2NS and a molecular weight of 281.30 g/mol.
| Compound Name | CID 163661867 |
|---|---|
| PubChem CID | 163661867 |
| Molecular Formula | C14H13Al2NS |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | — |
| SMILES | C[Al]N([Al]C)c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C12H7NS.2CH3.2Al/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10;;;;/h1-7H;2*1H3;; |
| InChIKey | DYUCAJHQCZUVKG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |