C24H32N2O2 — CID 163662032
[(3S,10R,13S)-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163662032) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(3S,10R,13S)-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10R,13S)-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163662032 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | [(3S,10R,13S)-10,13-dimethyl-17-pyrazol-1-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(n4cccn4)=CCC32)C1 |
| InChI | InChI=1S/C24H32N2O2/c1-16(27)28-18-9-11-23(2)17(15-18)5-6-19-20-7-8-22(26-14-4-13-25-26)24(20,3)12-10-21(19)23/h4-5,8,13-14,18-21H,6-7,9-12,15H2,1-3H3/t18-,19?,20?,21?,23-,24-/m0/s1 |
| InChIKey | IVFKRMVXLIWYGH-IPYNFABXSA-N |
| XLogP | 5.23 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|