C16H19FN2O3 — CID 163662416
3-butyl-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione (PubChem CID 163662416) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 3-butyl-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione.
| Compound Name | 3-butyl-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
|---|---|
| PubChem CID | 163662416 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 3-butyl-7a-(3-fluorophenyl)-6-methyl-1,3-dihydroimidazo[1,5-c][1,3]oxazole-5,7-dione |
| SMILES | CCCCC1OCC2(c3cccc(F)c3)C(=O)N(C)C(=O)N12 |
| InChI | InChI=1S/C16H19FN2O3/c1-3-4-8-13-19-15(21)18(2)14(20)16(19,10-22-13)11-6-5-7-12(17)9-11/h5-7,9,13H,3-4,8,10H2,1-2H3 |
| InChIKey | IVNFIZRRTUTCHC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|