C6H9N2O2- — CID 163663520
5-methyl-2-oxido-3,6-dihydro-1H-diazepin-7-one (PubChem CID 163663520) has the molecular formula C6H9N2O2- and a molecular weight of 141.15 g/mol. Its IUPAC name is 5-methyl-2-oxido-3,6-dihydro-1H-diazepin-7-one.
| Compound Name | 5-methyl-2-oxido-3,6-dihydro-1H-diazepin-7-one |
|---|---|
| PubChem CID | 163663520 |
| Molecular Formula | C6H9N2O2- |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 5-methyl-2-oxido-3,6-dihydro-1H-diazepin-7-one |
| SMILES | CC1=CCN([O-])NC(=O)C1 |
| InChI | InChI=1S/C6H9N2O2/c1-5-2-3-8(10)7-6(9)4-5/h2H,3-4H2,1H3,(H,7,9)/q-1 |
| InChIKey | XMXUFIIGWRJGNM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|