About N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine
N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine (PubChem CID 163663761) has the molecular formula C17H22N6
and a molecular weight of 310.41 g/mol. Its IUPAC name is N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine.
Molecular Properties
| Compound Name | N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine |
| PubChem CID | 163663761 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine |
| SMILES | Cc1cc(C)c(CNc2nc(C)nc3c2ncn3C(C)C)cn1 |
| InChI | InChI=1S/C17H22N6/c1-10(2)23-9-20-15-16(21-13(5)22-17(15)23)19-8-14-7-18-12(4)6-11(14)3/h6-7,9-10H,8H2,1-5H3,(H,19,21,22) |
| InChIKey | IWOYYCDJEKCAGD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine?
The IUPAC name of N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine (CID 163663761) is N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine.
What is the SMILES notation for N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine?
The canonical SMILES for N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine is Cc1cc(C)c(CNc2nc(C)nc3c2ncn3C(C)C)cn1.
What is the InChIKey of N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine?
The InChIKey is IWOYYCDJEKCAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6/c1-10(2)23-9-20-15-16(21-13(5)22-17(15)23)19-8-14-7-18-12(4)6-11(14)3/h6-7,9-10H,8H2,1-5H3,(H,19,21,22).
What are the key properties of N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine?
N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine has a molecular weight of 310.41 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethyl-3-pyridinyl)methyl]-2-methyl-9-propan-2-ylpurin-6-amine is sourced from PubChem (CID 163663761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).