About 6-iodo-N,1-dimethylindazol-3-amine
6-iodo-N,1-dimethylindazol-3-amine (PubChem CID 163664184) has the molecular formula C9H10IN3
and a molecular weight of 287.10 g/mol. Its IUPAC name is 6-iodo-N,1-dimethylindazol-3-amine.
Molecular Properties
| Compound Name | 6-iodo-N,1-dimethylindazol-3-amine |
| PubChem CID | 163664184 |
| Molecular Formula | C9H10IN3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 6-iodo-N,1-dimethylindazol-3-amine |
| SMILES | CNc1nn(C)c2cc(I)ccc12 |
| InChI | InChI=1S/C9H10IN3/c1-11-9-7-4-3-6(10)5-8(7)13(2)12-9/h3-5H,1-2H3,(H,11,12) |
| InChIKey | IWYRZIJETKCQEC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-N,1-dimethylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-N,1-dimethylindazol-3-amine?
The IUPAC name of 6-iodo-N,1-dimethylindazol-3-amine (CID 163664184) is 6-iodo-N,1-dimethylindazol-3-amine.
What is the SMILES notation for 6-iodo-N,1-dimethylindazol-3-amine?
The canonical SMILES for 6-iodo-N,1-dimethylindazol-3-amine is CNc1nn(C)c2cc(I)ccc12.
What is the InChIKey of 6-iodo-N,1-dimethylindazol-3-amine?
The InChIKey is IWYRZIJETKCQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10IN3/c1-11-9-7-4-3-6(10)5-8(7)13(2)12-9/h3-5H,1-2H3,(H,11,12).
What are the key properties of 6-iodo-N,1-dimethylindazol-3-amine?
6-iodo-N,1-dimethylindazol-3-amine has a molecular weight of 287.10 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-N,1-dimethylindazol-3-amine is sourced from PubChem (CID 163664184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).