About 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine
8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine (PubChem CID 163664371) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine.
Molecular Properties
| Compound Name | 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine |
| PubChem CID | 163664371 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine |
| SMILES | C=C(/C=C\C)CCc1cnc2c(N)nc3cc(C)ccc3c2c1 |
| InChI | InChI=1S/C20H21N3/c1-4-5-13(2)6-8-15-11-17-16-9-7-14(3)10-18(16)23-20(21)19(17)22-12-15/h4-5,7,9-12H,2,6,8H2,1,3H3,(H2,21,23)/b5-4- |
| InChIKey | IXDDTNXBFIAKHQ-PLNGDYQASA-N |
| XLogP | 4.74 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine?
The IUPAC name of 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine (CID 163664371) is 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine.
What is the SMILES notation for 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine?
The canonical SMILES for 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine is C=C(/C=C\C)CCc1cnc2c(N)nc3cc(C)ccc3c2c1.
What is the InChIKey of 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine?
The InChIKey is IXDDTNXBFIAKHQ-PLNGDYQASA-N. The full InChI is InChI=1S/C20H21N3/c1-4-5-13(2)6-8-15-11-17-16-9-7-14(3)10-18(16)23-20(21)19(17)22-12-15/h4-5,7,9-12H,2,6,8H2,1,3H3,(H2,21,23)/b5-4-.
What are the key properties of 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine?
8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine has a molecular weight of 303.41 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-[(Z)-3-methylidenehex-4-enyl]benzo[f][1,7]naphthyridin-5-amine is sourced from PubChem (CID 163664371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).