About 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene
5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene (PubChem CID 163664552) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene.
Molecular Properties
| Compound Name | 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene |
| PubChem CID | 163664552 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene |
| SMILES | CCCN1C=CN=C2CC21 |
| InChI | InChI=1S/C8H12N2/c1-2-4-10-5-3-9-7-6-8(7)10/h3,5,8H,2,4,6H2,1H3 |
| InChIKey | IXGUUBDEXXCZMR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene?
The IUPAC name of 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene (CID 163664552) is 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene.
What is the SMILES notation for 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene?
The canonical SMILES for 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene is CCCN1C=CN=C2CC21.
What is the InChIKey of 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene?
The InChIKey is IXGUUBDEXXCZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-4-10-5-3-9-7-6-8(7)10/h3,5,8H,2,4,6H2,1H3.
What are the key properties of 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene?
5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene has a molecular weight of 136.20 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-2,5-diazabicyclo[4.1.0]hepta-1,3-diene is sourced from PubChem (CID 163664552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).