C19H26O4 — CID 163664555
(3,3,5-trimethylcyclohexyl) 6-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 163664555) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 6-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 6-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 163664555 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 6-prop-2-enoyloxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=CC(=O)OC1CC=CC=C1C(=O)OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C19H26O4/c1-5-17(20)23-16-9-7-6-8-15(16)18(21)22-14-10-13(2)11-19(3,4)12-14/h5-8,13-14,16H,1,9-12H2,2-4H3 |
| InChIKey | IXGWOOYLLWOOIF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|