C21H34 — CID 163664655
(1R,2R,11S,14R)-11,13-diethyl-10,11,14-trimethylpentacyclo[6.5.1.02,7.09,12.012,14]tetradecane (PubChem CID 163664655) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (1R,2R,11S,14R)-11,13-diethyl-10,11,14-trimethylpentacyclo[6.5.1.02,7.09,12.012,14]tetradecane.
| Compound Name | (1R,2R,11S,14R)-11,13-diethyl-10,11,14-trimethylpentacyclo[6.5.1.02,7.09,12.012,14]tetradecane |
|---|---|
| PubChem CID | 163664655 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (1R,2R,11S,14R)-11,13-diethyl-10,11,14-trimethylpentacyclo[6.5.1.02,7.09,12.012,14]tetradecane |
| SMILES | CCC1[C@H]2[C@@H]3CCCCC3C3C4C(C)[C@](C)(CC)C41[C@@]32C |
| InChI | InChI=1S/C21H34/c1-6-15-17-13-10-8-9-11-14(13)18-16-12(3)19(4,7-2)21(15,16)20(17,18)5/h12-18H,6-11H2,1-5H3/t12?,13-,14?,15?,16?,17-,18?,19+,20-,21?/m1/s1 |
| InChIKey | IXIZVUZBDCSRPM-YAEPRZORSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |