C56H44N2O2 — CID 163664689
3,7-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-1,9a-dihydroanthracene-9,10-dione (PubChem CID 163664689) has the molecular formula C56H44N2O2 and a molecular weight of 776.98 g/mol. Its IUPAC name is 3,7-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-1,9a-dihydroanthracene-9,10-dione.
| Compound Name | 3,7-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-1,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 163664689 |
| Molecular Formula | C56H44N2O2 |
| Molecular Weight | 776.98 g/mol |
| Exact Mass | 776.34 |
| IUPAC Name | 3,7-bis[4-(9,9-dimethylacridin-10-yl)phenyl]-1,9a-dihydroanthracene-9,10-dione |
| SMILES | CC1(C)c2ccccc2N(c2ccc(C3=CCC4C(=O)c5cc(-c6ccc(N7c8ccccc8C(C)(C)c8ccccc87)cc6)ccc5C(=O)C4=C3)cc2)c2ccccc21 |
| InChI | InChI=1S/C56H44N2O2/c1-55(2)45-13-5-9-17-49(45)57(50-18-10-6-14-46(50)55)39-27-21-35(22-28-39)37-25-31-41-43(33-37)53(59)42-32-26-38(34-44(42)54(41)60)36-23-29-40(30-24-36)58-51-19-11-7-15-47(51)56(3,4)48-16-8-12-20-52(48)58/h5-31,33-34,42H,32H2,1-4H3 |
| InChIKey | IXJNDIAZZOUVHP-UHFFFAOYSA-N |
| XLogP | 13.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.98 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|