About 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one
5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one (PubChem CID 163664717) has the molecular formula C12H12Cl2N2O2
and a molecular weight of 287.15 g/mol. Its IUPAC name is 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one.
Molecular Properties
| Compound Name | 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one |
| PubChem CID | 163664717 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one |
| SMILES | CCc1nc2c(O)c(Cl)cc(Cl)c2c(=O)n1CC |
| InChI | InChI=1S/C12H12Cl2N2O2/c1-3-8-15-10-9(12(18)16(8)4-2)6(13)5-7(14)11(10)17/h5,17H,3-4H2,1-2H3 |
| InChIKey | IXKFPIIGISHVKV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one?
The IUPAC name of 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one (CID 163664717) is 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one.
What is the SMILES notation for 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one?
The canonical SMILES for 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one is CCc1nc2c(O)c(Cl)cc(Cl)c2c(=O)n1CC.
What is the InChIKey of 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one?
The InChIKey is IXKFPIIGISHVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O2/c1-3-8-15-10-9(12(18)16(8)4-2)6(13)5-7(14)11(10)17/h5,17H,3-4H2,1-2H3.
What are the key properties of 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one?
5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one has a molecular weight of 287.15 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2,3-diethyl-8-hydroxyquinazolin-4-one is sourced from PubChem (CID 163664717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).