C12H22N2S — CID 163666290
(2R)-2,3-dimethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1,3-thiazolidine (PubChem CID 163666290) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is (2R)-2,3-dimethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1,3-thiazolidine.
| Compound Name | (2R)-2,3-dimethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 163666290 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2R)-2,3-dimethyl-4-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-1,3-thiazolidine |
| SMILES | C[C@H]1SCC(CC2=CCCN(C)C2)N1C |
| InChI | InChI=1S/C12H22N2S/c1-10-14(3)12(9-15-10)7-11-5-4-6-13(2)8-11/h5,10,12H,4,6-9H2,1-3H3/t10-,12?/m1/s1 |
| InChIKey | IYTHDQHCTNPDMX-RWANSRKNSA-N |
| XLogP | 2.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|