C21H25O2P2+ — CID 163666585
[4-(carboxymethyl)-2-diphenylphosphanylspiro[2.4]heptan-7-yl]phosphanium (PubChem CID 163666585) has the molecular formula C21H25O2P2+ and a molecular weight of 371.38 g/mol. Its IUPAC name is [4-(carboxymethyl)-2-diphenylphosphanylspiro[2.4]heptan-7-yl]phosphanium.
| Compound Name | [4-(carboxymethyl)-2-diphenylphosphanylspiro[2.4]heptan-7-yl]phosphanium |
|---|---|
| PubChem CID | 163666585 |
| Molecular Formula | C21H25O2P2+ |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [4-(carboxymethyl)-2-diphenylphosphanylspiro[2.4]heptan-7-yl]phosphanium |
| SMILES | O=C(O)CC1CCC([PH3+])C12CC2P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O2P2/c22-20(23)13-15-11-12-18(24)21(15)14-19(21)25(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,15,18-19H,11-14,24H2,(H,22,23)/p+1 |
| InChIKey | IYZVATAZLJVUJY-UHFFFAOYSA-O |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|