About 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene
1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene (PubChem CID 163666620) has the molecular formula C8H10FNO2
and a molecular weight of 171.17 g/mol. Its IUPAC name is 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene |
| PubChem CID | 163666620 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene |
| SMILES | CC1=CCC(C)([N+](=O)[O-])C(F)=C1 |
| InChI | InChI=1S/C8H10FNO2/c1-6-3-4-8(2,10(11)12)7(9)5-6/h3,5H,4H2,1-2H3 |
| InChIKey | IZAOHVQYTGCYRO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene?
The IUPAC name of 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene (CID 163666620) is 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene.
What is the SMILES notation for 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene?
The canonical SMILES for 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene is CC1=CCC(C)([N+](=O)[O-])C(F)=C1.
What is the InChIKey of 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene?
The InChIKey is IZAOHVQYTGCYRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO2/c1-6-3-4-8(2,10(11)12)7(9)5-6/h3,5H,4H2,1-2H3.
What are the key properties of 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene?
1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene has a molecular weight of 171.17 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,6-dimethyl-6-nitrocyclohexa-1,3-diene is sourced from PubChem (CID 163666620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).