C15H13BrO8 — CID 163666904
[(6S)-3,12-dioxo-4,9,13,16-tetraoxahexacyclo[12.2.1.02,8.02,11.06,10.011,15]heptadecan-6-yl] 2-bromoacetate (PubChem CID 163666904) has the molecular formula C15H13BrO8 and a molecular weight of 401.17 g/mol. Its IUPAC name is [(6S)-3,12-dioxo-4,9,13,16-tetraoxahexacyclo[12.2.1.02,8.02,11.06,10.011,15]heptadecan-6-yl] 2-bromoacetate.
| Compound Name | [(6S)-3,12-dioxo-4,9,13,16-tetraoxahexacyclo[12.2.1.02,8.02,11.06,10.011,15]heptadecan-6-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 163666904 |
| Molecular Formula | C15H13BrO8 |
| Molecular Weight | 401.17 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | [(6S)-3,12-dioxo-4,9,13,16-tetraoxahexacyclo[12.2.1.02,8.02,11.06,10.011,15]heptadecan-6-yl] 2-bromoacetate |
| SMILES | O=C(CBr)O[C@@]12COC(=O)C34C5CC6OC(=O)C3(C6O5)C1OC4C2 |
| InChI | InChI=1S/C15H13BrO8/c16-3-8(17)24-13-2-7-14(11(18)20-4-13)6-1-5-9(22-6)15(14,10(13)23-7)12(19)21-5/h5-7,9-10H,1-4H2/t5?,6?,7?,9?,10?,13-,14?,15?/m0/s1 |
| InChIKey | IZGDUPUNNOIVNF-FYZHIEQUSA-N |
| XLogP | -0.54 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.17 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|