About 3-ethenyl-1,9-dimethylpurine-2,6-dione
3-ethenyl-1,9-dimethylpurine-2,6-dione (PubChem CID 163667469) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-ethenyl-1,9-dimethylpurine-2,6-dione.
Molecular Properties
| Compound Name | 3-ethenyl-1,9-dimethylpurine-2,6-dione |
| PubChem CID | 163667469 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-ethenyl-1,9-dimethylpurine-2,6-dione |
| SMILES | C=Cn1c(=O)n(C)c(=O)c2ncn(C)c21 |
| InChI | InChI=1S/C9H10N4O2/c1-4-13-7-6(10-5-11(7)2)8(14)12(3)9(13)15/h4-5H,1H2,2-3H3 |
| InChIKey | IZSNFTAWAWKGAL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethenyl-1,9-dimethylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,9-dimethylpurine-2,6-dione?
The IUPAC name of 3-ethenyl-1,9-dimethylpurine-2,6-dione (CID 163667469) is 3-ethenyl-1,9-dimethylpurine-2,6-dione.
What is the SMILES notation for 3-ethenyl-1,9-dimethylpurine-2,6-dione?
The canonical SMILES for 3-ethenyl-1,9-dimethylpurine-2,6-dione is C=Cn1c(=O)n(C)c(=O)c2ncn(C)c21.
What is the InChIKey of 3-ethenyl-1,9-dimethylpurine-2,6-dione?
The InChIKey is IZSNFTAWAWKGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-4-13-7-6(10-5-11(7)2)8(14)12(3)9(13)15/h4-5H,1H2,2-3H3.
What are the key properties of 3-ethenyl-1,9-dimethylpurine-2,6-dione?
3-ethenyl-1,9-dimethylpurine-2,6-dione has a molecular weight of 206.20 g/mol, XLogP of -0.47, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,9-dimethylpurine-2,6-dione is sourced from PubChem (CID 163667469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).