C18H15NO4 — CID 163667904
5a,8,9-trihydroxy-3-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromene-4-carbonitrile (PubChem CID 163667904) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 5a,8,9-trihydroxy-3-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromene-4-carbonitrile.
| Compound Name | 5a,8,9-trihydroxy-3-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromene-4-carbonitrile |
|---|---|
| PubChem CID | 163667904 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5a,8,9-trihydroxy-3-methyl-10b,11-dihydro-6H-indeno[2,1-b]chromene-4-carbonitrile |
| SMILES | Cc1ccc2c(c1C#N)OC1(O)Cc3cc(O)c(O)cc3C1C2 |
| InChI | InChI=1S/C18H15NO4/c1-9-2-3-10-4-14-12-6-16(21)15(20)5-11(12)7-18(14,22)23-17(10)13(9)8-19/h2-3,5-6,14,20-22H,4,7H2,1H3 |
| InChIKey | NZPUEAPPUJYRMX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|