About 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid
2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid (PubChem CID 163668412) has the molecular formula C8H10O2S
and a molecular weight of 170.23 g/mol. Its IUPAC name is 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid |
| PubChem CID | 163668412 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid |
| SMILES | O=C(O)CC1=CC=C(S)CC1 |
| InChI | InChI=1S/C8H10O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1,3,11H,2,4-5H2,(H,9,10) |
| InChIKey | JAKZWXDRSYMKGG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid?
The IUPAC name of 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid (CID 163668412) is 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid?
The canonical SMILES for 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid is O=C(O)CC1=CC=C(S)CC1.
What is the InChIKey of 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid?
The InChIKey is JAKZWXDRSYMKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S/c9-8(10)5-6-1-3-7(11)4-2-6/h1,3,11H,2,4-5H2,(H,9,10).
What are the key properties of 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid?
2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid has a molecular weight of 170.23 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-sulfanylcyclohexa-1,3-dien-1-yl)acetic acid is sourced from PubChem (CID 163668412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).