C61H82AlF2N11O16 — CID 163669110
CID 163669110 (PubChem CID 163669110) has the molecular formula C61H82AlF2N11O16 and a molecular weight of 1290.37 g/mol.
| Compound Name | CID 163669110 |
|---|---|
| PubChem CID | 163669110 |
| Molecular Formula | C61H82AlF2N11O16 |
| Molecular Weight | 1290.37 g/mol |
| Exact Mass | 1289.57 |
| IUPAC Name | — |
| SMILES | C[C@H](NC(=O)CNC(=O)CCCCCN1C(=O)CC(C(C)(C)[Al])C1=O)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCN(C(=O)CO)[C@@H](c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C(C)(C)C)C(=O)NCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C61H82F2N11O16.Al/c1-34(2)40-28-51(80)74(59(40)88)24-13-9-12-16-48(77)66-30-50(79)67-35(3)55(84)68-36(4)56(85)71-45(29-47(64)76)58(87)70-43(57(86)65-23-21-49(78)69-44(60(89)90)19-20-53(82)83)22-25-73(52(81)33-75)54(61(5,6)7)46-26-38(41-27-39(62)17-18-42(41)63)32-72(46)31-37-14-10-8-11-15-37;/h8,10-11,14-15,17-18,26-27,32,35-36,40,43-45,54,75H,9,12-13,16,19-25,28-31,33H2,1-7H3,(H2,64,76)(H,65,86)(H,66,77)(H,67,79)(H,68,84)(H,69,78)(H,70,87)(H,71,85)(H,82,83)(H,89,90);/t35-,36-,40?,43-,44-,45-,54-;/m0./s1 |
| InChIKey | XHGCAIIUQNYEQN-NIRXSKTOSA-N |
| XLogP | 0.99 |
| TPSA | 404.24 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1290.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|