About 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide
3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 163669266) has the molecular formula C17H25FN2O2
and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 163669266 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | CN(C)C(=O)CCC/C=C\C1=CC(C(=O)NCCF)CC=C1 |
| InChI | InChI=1S/C17H25FN2O2/c1-20(2)16(21)10-5-3-4-7-14-8-6-9-15(13-14)17(22)19-12-11-18/h4,6-8,13,15H,3,5,9-12H2,1-2H3,(H,19,22)/b7-4- |
| InChIKey | JBCIIMACQBQKJO-DAXSKMNVSA-N |
| XLogP | 2.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide (CID 163669266) is 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide is CN(C)C(=O)CCC/C=C\C1=CC(C(=O)NCCF)CC=C1.
What is the InChIKey of 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide?
The InChIKey is JBCIIMACQBQKJO-DAXSKMNVSA-N. The full InChI is InChI=1S/C17H25FN2O2/c1-20(2)16(21)10-5-3-4-7-14-8-6-9-15(13-14)17(22)19-12-11-18/h4,6-8,13,15H,3,5,9-12H2,1-2H3,(H,19,22)/b7-4-.
What are the key properties of 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide?
3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide has a molecular weight of 308.40 g/mol, XLogP of 2.39, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]-N-(2-fluoroethyl)cyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 163669266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).