About 1-cyclopropyl-7,8-difluoronaphthalen-2-ol
1-cyclopropyl-7,8-difluoronaphthalen-2-ol (PubChem CID 163669592) has the molecular formula C13H10F2O
and a molecular weight of 220.22 g/mol. Its IUPAC name is 1-cyclopropyl-7,8-difluoronaphthalen-2-ol.
Molecular Properties
| Compound Name | 1-cyclopropyl-7,8-difluoronaphthalen-2-ol |
| PubChem CID | 163669592 |
| Molecular Formula | C13H10F2O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 1-cyclopropyl-7,8-difluoronaphthalen-2-ol |
| SMILES | Oc1ccc2ccc(F)c(F)c2c1C1CC1 |
| InChI | InChI=1S/C13H10F2O/c14-9-5-3-8-4-6-10(16)11(7-1-2-7)12(8)13(9)15/h3-7,16H,1-2H2 |
| InChIKey | JBIVOAQFYLLDBR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-7,8-difluoronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-7,8-difluoronaphthalen-2-ol?
The IUPAC name of 1-cyclopropyl-7,8-difluoronaphthalen-2-ol (CID 163669592) is 1-cyclopropyl-7,8-difluoronaphthalen-2-ol.
What is the SMILES notation for 1-cyclopropyl-7,8-difluoronaphthalen-2-ol?
The canonical SMILES for 1-cyclopropyl-7,8-difluoronaphthalen-2-ol is Oc1ccc2ccc(F)c(F)c2c1C1CC1.
What is the InChIKey of 1-cyclopropyl-7,8-difluoronaphthalen-2-ol?
The InChIKey is JBIVOAQFYLLDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F2O/c14-9-5-3-8-4-6-10(16)11(7-1-2-7)12(8)13(9)15/h3-7,16H,1-2H2.
What are the key properties of 1-cyclopropyl-7,8-difluoronaphthalen-2-ol?
1-cyclopropyl-7,8-difluoronaphthalen-2-ol has a molecular weight of 220.22 g/mol, XLogP of 3.70, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-7,8-difluoronaphthalen-2-ol is sourced from PubChem (CID 163669592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).