C18H29N2O2+ — CID 163669649
2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]ethyl-(3-hydroxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium (PubChem CID 163669649) has the molecular formula C18H29N2O2+ and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]ethyl-(3-hydroxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium.
| Compound Name | 2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]ethyl-(3-hydroxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
|---|---|
| PubChem CID | 163669649 |
| Molecular Formula | C18H29N2O2+ |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]ethyl-(3-hydroxy-5,5-dimethylcyclohex-2-en-1-ylidene)azanium |
| SMILES | CC1(C)CC(=O)C=C(NCC/[NH+]=C2\C=C(O)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-17(2)9-13(7-15(21)11-17)19-5-6-20-14-8-16(22)12-18(3,4)10-14/h7-8,19,22H,5-6,9-12H2,1-4H3/p+1/b20-14+ |
| InChIKey | QMVYQKLEPXYMGJ-XSFVSMFZSA-O |
| XLogP | 1.63 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|