C65H58N4 — CID 163669728
9-[4-tert-butyl-5-(4-tert-butylphenyl)-2-pyridinyl]-2-[diphenyl-[3-[3-(2-phenylphenyl)-2H-imidazol-1-yl]phenyl]methyl]carbazole (PubChem CID 163669728) has the molecular formula C65H58N4 and a molecular weight of 895.21 g/mol. Its IUPAC name is 9-[4-tert-butyl-5-(4-tert-butylphenyl)-2-pyridinyl]-2-[diphenyl-[3-[3-(2-phenylphenyl)-2H-imidazol-1-yl]phenyl]methyl]carbazole.
| Compound Name | 9-[4-tert-butyl-5-(4-tert-butylphenyl)-2-pyridinyl]-2-[diphenyl-[3-[3-(2-phenylphenyl)-2H-imidazol-1-yl]phenyl]methyl]carbazole |
|---|---|
| PubChem CID | 163669728 |
| Molecular Formula | C65H58N4 |
| Molecular Weight | 895.21 g/mol |
| Exact Mass | 894.47 |
| IUPAC Name | 9-[4-tert-butyl-5-(4-tert-butylphenyl)-2-pyridinyl]-2-[diphenyl-[3-[3-(2-phenylphenyl)-2H-imidazol-1-yl]phenyl]methyl]carbazole |
| SMILES | CC(C)(C)c1ccc(-c2cnc(-n3c4ccccc4c4ccc(C(c5ccccc5)(c5ccccc5)c5cccc(N6C=CN(c7ccccc7-c7ccccc7)C6)c5)cc43)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C65H58N4/c1-63(2,3)48-35-33-47(34-36-48)57-44-66-62(43-58(57)64(4,5)6)69-60-32-19-17-30-55(60)56-38-37-52(42-61(56)69)65(49-23-12-8-13-24-49,50-25-14-9-15-26-50)51-27-20-28-53(41-51)67-39-40-68(45-67)59-31-18-16-29-54(59)46-21-10-7-11-22-46/h7-44H,45H2,1-6H3 |
| InChIKey | RNWSEQYRBHYVPG-UHFFFAOYSA-N |
| XLogP | 16.25 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.21 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|