C18H26O10 — CID 163670024
[(3R,6S)-3,4,5-triacetyloxy-6-[(E)-but-2-en-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 163670024) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-but-2-en-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-but-2-en-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163670024 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(3R,6S)-3,4,5-triacetyloxy-6-[(E)-but-2-en-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | C/C=C(\C)O[C@@H]1OC(COC(C)=O)[C@@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H26O10/c1-7-9(2)24-18-17(27-13(6)22)16(26-12(5)21)15(25-11(4)20)14(28-18)8-23-10(3)19/h7,14-18H,8H2,1-6H3/b9-7+/t14?,15-,16?,17?,18-/m1/s1 |
| InChIKey | JBSODWDONYWUGP-NRQQVLFGSA-N |
| XLogP | 1.01 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|