C12H18N2O — CID 163670152
4-cyclopropyl-2-(2,2-dimethylpropoxy)pyrimidine (PubChem CID 163670152) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-cyclopropyl-2-(2,2-dimethylpropoxy)pyrimidine.
| Compound Name | 4-cyclopropyl-2-(2,2-dimethylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 163670152 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-cyclopropyl-2-(2,2-dimethylpropoxy)pyrimidine |
| SMILES | CC(C)(C)COc1nccc(C2CC2)n1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2,3)8-15-11-13-7-6-10(14-11)9-4-5-9/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | HSECJDFNUIEQOX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |