C27H49NO — CID 163670179
(6S,11Z,13E)-1-imino-6,8-dimethyl-4,8,13-tripropylhexadeca-11,13-dien-7-one (PubChem CID 163670179) has the molecular formula C27H49NO and a molecular weight of 403.70 g/mol. Its IUPAC name is (6S,11Z,13E)-1-imino-6,8-dimethyl-4,8,13-tripropylhexadeca-11,13-dien-7-one.
| Compound Name | (6S,11Z,13E)-1-imino-6,8-dimethyl-4,8,13-tripropylhexadeca-11,13-dien-7-one |
|---|---|
| PubChem CID | 163670179 |
| Molecular Formula | C27H49NO |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.38 |
| IUPAC Name | (6S,11Z,13E)-1-imino-6,8-dimethyl-4,8,13-tripropylhexadeca-11,13-dien-7-one |
| SMILES | [H]/N=C/CCC(CCC)C[C@H](C)C(=O)C(C)(CCC)CC/C=C\C(=C\CC)CCC |
| InChI | InChI=1S/C27H49NO/c1-7-14-24(15-8-2)17-11-12-20-27(6,19-10-4)26(29)23(5)22-25(16-9-3)18-13-21-28/h11,14,17,21,23,25,28H,7-10,12-13,15-16,18-20,22H2,1-6H3/b17-11-,24-14+,28-21+/t23-,25?,27?/m0/s1 |
| InChIKey | JBVNXEOYPMAVIT-GCNPURJPSA-N |
| XLogP | 8.71 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|