C10H10N4O — CID 163670356
1-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]ethenol (PubChem CID 163670356) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 1-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]ethenol.
| Compound Name | 1-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]ethenol |
|---|---|
| PubChem CID | 163670356 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-[6-(5-methyl-1H-1,2,4-triazol-3-yl)-3-pyridinyl]ethenol |
| SMILES | C=C(O)c1ccc(-c2n[nH]c(C)n2)nc1 |
| InChI | InChI=1S/C10H10N4O/c1-6(15)8-3-4-9(11-5-8)10-12-7(2)13-14-10/h3-5,15H,1H2,2H3,(H,12,13,14) |
| InChIKey | JBZOAYILWWZGPM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|