C22H22FIN4 — CID 163671130
N-(4-fluorophenyl)-4-[1-(iodomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6-dimethylpyrimidin-2-amine (PubChem CID 163671130) has the molecular formula C22H22FIN4 and a molecular weight of 488.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[1-(iodomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6-dimethylpyrimidin-2-amine.
| Compound Name | N-(4-fluorophenyl)-4-[1-(iodomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163671130 |
| Molecular Formula | C22H22FIN4 |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | N-(4-fluorophenyl)-4-[1-(iodomethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-5,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1nc(Nc2ccc(F)cc2)nc(N2CCc3ccccc3C2CI)c1C |
| InChI | InChI=1S/C22H22FIN4/c1-14-15(2)25-22(26-18-9-7-17(23)8-10-18)27-21(14)28-12-11-16-5-3-4-6-19(16)20(28)13-24/h3-10,20H,11-13H2,1-2H3,(H,25,26,27) |
| InChIKey | JCPXSTQXHUQNGN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|