C33H29NO3 — CID 163671551
2-[2-tert-butyl-6-[(Z)-2-(9-methyl-4b,5-dihydrocarbazol-3-yl)ethenyl]pyran-4-ylidene]indene-1,3-dione (PubChem CID 163671551) has the molecular formula C33H29NO3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-[(Z)-2-(9-methyl-4b,5-dihydrocarbazol-3-yl)ethenyl]pyran-4-ylidene]indene-1,3-dione.
| Compound Name | 2-[2-tert-butyl-6-[(Z)-2-(9-methyl-4b,5-dihydrocarbazol-3-yl)ethenyl]pyran-4-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 163671551 |
| Molecular Formula | C33H29NO3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[2-tert-butyl-6-[(Z)-2-(9-methyl-4b,5-dihydrocarbazol-3-yl)ethenyl]pyran-4-ylidene]indene-1,3-dione |
| SMILES | CN1C2=CC=CCC2c2cc(/C=C\C3=CC(=C4C(=O)c5ccccc5C4=O)C=C(C(C)(C)C)O3)ccc21 |
| InChI | InChI=1S/C33H29NO3/c1-33(2,3)29-19-21(30-31(35)24-10-5-6-11-25(24)32(30)36)18-22(37-29)15-13-20-14-16-28-26(17-20)23-9-7-8-12-27(23)34(28)4/h5-8,10-19,23H,9H2,1-4H3/b15-13- |
| InChIKey | JCZVPTKYHRHYPP-SQFISAMPSA-N |
| XLogP | 7.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|