C7H8Cl2F6O — CID 163671932
3-chloro-3-(1-chloro-3,3,3-trifluoropropoxy)-1,1,1-trifluorobutane (PubChem CID 163671932) has the molecular formula C7H8Cl2F6O and a molecular weight of 293.03 g/mol. Its IUPAC name is 3-chloro-3-(1-chloro-3,3,3-trifluoropropoxy)-1,1,1-trifluorobutane.
| Compound Name | 3-chloro-3-(1-chloro-3,3,3-trifluoropropoxy)-1,1,1-trifluorobutane |
|---|---|
| PubChem CID | 163671932 |
| Molecular Formula | C7H8Cl2F6O |
| Molecular Weight | 293.03 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 3-chloro-3-(1-chloro-3,3,3-trifluoropropoxy)-1,1,1-trifluorobutane |
| SMILES | CC(Cl)(CC(F)(F)F)OC(Cl)CC(F)(F)F |
| InChI | InChI=1S/C7H8Cl2F6O/c1-5(9,3-7(13,14)15)16-4(8)2-6(10,11)12/h4H,2-3H2,1H3 |
| InChIKey | JDHXRQUMDGKBAG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.03 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|