C26H45N3O — CID 163671935
(2S,3Z,6R,7E,11S)-11-(1-hydroxycyclohexyl)-2,6,7,11-tetramethyl-12-piperazin-1-yldodeca-3,7-dienenitrile (PubChem CID 163671935) has the molecular formula C26H45N3O and a molecular weight of 415.67 g/mol. Its IUPAC name is (2S,3Z,6R,7E,11S)-11-(1-hydroxycyclohexyl)-2,6,7,11-tetramethyl-12-piperazin-1-yldodeca-3,7-dienenitrile.
| Compound Name | (2S,3Z,6R,7E,11S)-11-(1-hydroxycyclohexyl)-2,6,7,11-tetramethyl-12-piperazin-1-yldodeca-3,7-dienenitrile |
|---|---|
| PubChem CID | 163671935 |
| Molecular Formula | C26H45N3O |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | (2S,3Z,6R,7E,11S)-11-(1-hydroxycyclohexyl)-2,6,7,11-tetramethyl-12-piperazin-1-yldodeca-3,7-dienenitrile |
| SMILES | C/C(=C\CC[C@@](C)(CN1CCNCC1)C1(O)CCCCC1)[C@H](C)C/C=C\[C@H](C)C#N |
| InChI | InChI=1S/C26H45N3O/c1-22(20-27)10-8-11-23(2)24(3)12-9-13-25(4,21-29-18-16-28-17-19-29)26(30)14-6-5-7-15-26/h8,10,12,22-23,28,30H,5-7,9,11,13-19,21H2,1-4H3/b10-8-,24-12+/t22-,23+,25-/m0/s1 |
| InChIKey | JDHYMMXARQOHBD-HDWPHTRQSA-N |
| XLogP | 5.06 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|