C51H36N4 — CID 163672751
9-[9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-9,10-dihydrotriphenylen-2-yl]-1,2-dihydrocarbazole (PubChem CID 163672751) has the molecular formula C51H36N4 and a molecular weight of 704.88 g/mol. Its IUPAC name is 9-[9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-9,10-dihydrotriphenylen-2-yl]-1,2-dihydrocarbazole.
| Compound Name | 9-[9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-9,10-dihydrotriphenylen-2-yl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 163672751 |
| Molecular Formula | C51H36N4 |
| Molecular Weight | 704.88 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 9-[9-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]-9,10-dihydrotriphenylen-2-yl]-1,2-dihydrocarbazole |
| SMILES | C1=Cc2c(n(-c3ccc4c(c3)c3c(c5ccccc54)C(c4nc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)CC=C3)c3ccccc23)CC1 |
| InChI | InChI=1S/C51H36N4/c1-3-15-33(16-4-1)35-19-13-20-36(31-35)50-52-49(34-17-5-2-6-18-34)53-51(54-50)44-26-14-25-43-45-32-37(29-30-39(45)38-21-7-8-24-42(38)48(43)44)55-46-27-11-9-22-40(46)41-23-10-12-28-47(41)55/h1-11,13-25,27,29-32,44H,12,26,28H2 |
| InChIKey | JDZPBPBSWAQCAS-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.88 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|