C36H24NO3P — CID 163673404
(1R)-15-(3,6-dimethylcarbazol-9-yl)-12,18-dioxa-1λ5-phosphahexacyclo[11.11.1.02,11.03,8.017,25.019,24]pentacosa-2(11),3,5,7,9,13,15,17(25),19,21,23-undecaene 1-oxide (PubChem CID 163673404) has the molecular formula C36H24NO3P and a molecular weight of 549.57 g/mol. Its IUPAC name is (1R)-15-(3,6-dimethylcarbazol-9-yl)-12,18-dioxa-1λ5-phosphahexacyclo[11.11.1.02,11.03,8.017,25.019,24]pentacosa-2(11),3,5,7,9,13,15,17(25),19,21,23-undecaene 1-oxide.
| Compound Name | (1R)-15-(3,6-dimethylcarbazol-9-yl)-12,18-dioxa-1λ5-phosphahexacyclo[11.11.1.02,11.03,8.017,25.019,24]pentacosa-2(11),3,5,7,9,13,15,17(25),19,21,23-undecaene 1-oxide |
|---|---|
| PubChem CID | 163673404 |
| Molecular Formula | C36H24NO3P |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | (1R)-15-(3,6-dimethylcarbazol-9-yl)-12,18-dioxa-1λ5-phosphahexacyclo[11.11.1.02,11.03,8.017,25.019,24]pentacosa-2(11),3,5,7,9,13,15,17(25),19,21,23-undecaene 1-oxide |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1cc2c3c(c1)Oc1ccc4ccccc4c1[P@]3(=O)c1ccccc1O2 |
| InChI | InChI=1S/C36H24NO3P/c1-21-11-14-28-26(17-21)27-18-22(2)12-15-29(27)37(28)24-19-32-36-33(20-24)40-31-16-13-23-7-3-4-8-25(23)35(31)41(36,38)34-10-6-5-9-30(34)39-32/h3-20H,1-2H3/t41-/m1/s1 |
| InChIKey | JENORGPTRQJHBK-VQJSHJPSSA-N |
| XLogP | 8.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|