C27H50N4O3 — CID 163673543
(2R)-N-[1-[[(E)-6-(hexylamino)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 163673543) has the molecular formula C27H50N4O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is (2R)-N-[1-[[(E)-6-(hexylamino)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-[1-[[(E)-6-(hexylamino)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 163673543 |
| Molecular Formula | C27H50N4O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.39 |
| IUPAC Name | (2R)-N-[1-[[(E)-6-(hexylamino)-2,5-dimethyl-6-oxohex-4-en-3-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | CCCCCCNC(=O)/C(C)=C/C(C(C)C)N(C)C(=O)C(NC(=O)[C@H]1CCCCN1C)C(C)C |
| InChI | InChI=1S/C27H50N4O3/c1-9-10-11-13-16-28-25(32)21(6)18-23(19(2)3)31(8)27(34)24(20(4)5)29-26(33)22-15-12-14-17-30(22)7/h18-20,22-24H,9-17H2,1-8H3,(H,28,32)(H,29,33)/b21-18+/t22-,23?,24?/m1/s1 |
| InChIKey | JEQQRCPEZKTPJS-RGNZSRFCSA-N |
| XLogP | 3.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|